ChemNet > CAS > 16382-15-3 Ethyl 5-methylindole-2-carboxylate
16382-15-3 Ethyl 5-methylindole-2-carboxylate
| Naam product |
Ethyl 5-methylindole-2-carboxylate |
| Engelse naam |
Ethyl 5-methylindole-2-carboxylate; 5-Methylindole-2-carboxylic acid ethyl ester; ethyl 5-methyl-1H-indole-2-carboxylate |
| MF |
C12H13NO2 |
| Molecuulgewicht |
203.2371 |
| InChI |
InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| CAS-nummer |
16382-15-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.177g/cm3 |
| Kookpunt |
356.5°C at 760 mmHg |
| Brekingsindex |
1.609 |
| Vlampunt |
169.4°C |
| Dampdruk |
2.9E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
