ChemNet > CAS > 1646-53-3 1-bromo-2,3,5,6-tetramethylbenzene
1646-53-3 1-bromo-2,3,5,6-tetramethylbenzene
| Naam product |
1-bromo-2,3,5,6-tetramethylbenzene |
| Engelse naam |
1-bromo-2,3,5,6-tetramethylbenzene; Bromodurene, Pract.; 3-Bromodurene~3-Bromo-1,2,4,5-tetramethylbenzene~2,3,5,6-Tetramethylbromobenzene; 3-bromo-1,2,4,5-tetramethylbenzene |
| MF |
C10H13Br |
| Molecuulgewicht |
213.1142 |
| InChI |
InChI=1/C10H13Br/c1-6-5-7(2)9(4)10(11)8(6)3/h5H,1-4H3 |
| CAS-nummer |
1646-53-3 |
| EINECS |
216-707-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.248g/cm3 |
| Smeltpunt |
60-59℃ |
| Kookpunt |
256.6°C at 760 mmHg |
| Brekingsindex |
1.536 |
| Vlampunt |
108.9°C |
| Dampdruk |
0.0245mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
