ChemNet > CAS > 166744-78-1 4-Benzyloxy-2-fluorobenzeneboronic acid
166744-78-1 4-Benzyloxy-2-fluorobenzeneboronic acid
Naam product |
4-Benzyloxy-2-fluorobenzeneboronic acid |
Engelse naam |
4-Benzyloxy-2-fluorobenzeneboronic acid; 4-Benzyloxy-2-fluorophenylboronic acid |
MF |
C13H12BFO3 |
Molecuulgewicht |
246.042 |
InChI |
InChI=1/C13H12BFO3/c15-13-8-11(6-7-12(13)14(16)17)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 |
CAS-nummer |
166744-78-1 |
Moleculaire Structuur |
|
Dichtheid |
1.26g/cm3 |
Smeltpunt |
153℃ |
Kookpunt |
406.8°C at 760 mmHg |
Brekingsindex |
1.577 |
Vlampunt |
199.8°C |
Dampdruk |
2.4E-07mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|