ChemNet > CAS > 16718-12-0 2-(Phenylthio)thiophene
16718-12-0 2-(Phenylthio)thiophene
Naam product |
2-(Phenylthio)thiophene |
Engelse naam |
2-(Phenylthio)thiophene; Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
MF |
C10H8S2 |
Molecuulgewicht |
192.3005 |
InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
CAS-nummer |
16718-12-0 |
Moleculaire Structuur |
|
Dichtheid |
1.24g/cm3 |
Kookpunt |
304.7°C at 760 mmHg |
Brekingsindex |
1.667 |
Vlampunt |
138.1°C |
Dampdruk |
0.00155mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|