ChemNet > CAS > 1679-98-7 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole
1679-98-7 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole
Naam product |
2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
Engelse naam |
2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole; 2,5-Bis(4-diethylaminophenyl)-1,3,4-oxadiazole; 2,5-bis(diethylamino)phenyl-1,3,4-oxadiazole; 4,4'-(1,3,4-oxadiazole-2,5-diyl)bis(N,N-diethylaniline) |
MF |
C22H28N4O |
Molecuulgewicht |
364.4839 |
InChI |
InChI=1/C22H28N4O/c1-5-25(6-2)19-13-9-17(10-14-19)21-23-24-22(27-21)18-11-15-20(16-12-18)26(7-3)8-4/h9-16H,5-8H2,1-4H3 |
CAS-nummer |
1679-98-7 |
EINECS |
216-851-8 |
Moleculaire Structuur |
|
Dichtheid |
1.1g/cm3 |
Kookpunt |
526.4°C at 760 mmHg |
Brekingsindex |
1.585 |
Vlampunt |
272.2°C |
Dampdruk |
3.59E-11mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|