ChemNet > CAS > 1698-53-9 1-Phenyl-4,5-dichloro-6-pyridazone
1698-53-9 1-Phenyl-4,5-dichloro-6-pyridazone
| Naam product |
1-Phenyl-4,5-dichloro-6-pyridazone |
| Engelse naam |
1-Phenyl-4,5-dichloro-6-pyridazone; 4,5-dichloro-2,3-dihydro-2-phenylpyridazin-3-one; 4,5-Dichloro-2-phenylpyridazin-3(2H)one; 4,5-dichloro-2-phenyl-2,3-dihydropyridazin-3-one; 4-oxo-7-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxylic acid; 4,5-dichloropyridazin-3(2H)-one |
| MF |
C4H2Cl2N2O |
| Molecuulgewicht |
164.9775 |
| InChI |
InChI=1/C4H2Cl2N2O/c5-2-1-7-8-4(9)3(2)6/h1H,(H,8,9) |
| CAS-nummer |
1698-53-9 |
| EINECS |
216-917-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.76g/cm3 |
| Smeltpunt |
164-166℃ |
| Kookpunt |
339.2°C at 760 mmHg |
| Brekingsindex |
1.661 |
| Vlampunt |
159°C |
| Dampdruk |
4.74E-05mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
