ChemNet > CAS > 1700-30-7 3-Benzyloxybenzyl alcohol
1700-30-7 3-Benzyloxybenzyl alcohol
Naam product |
3-Benzyloxybenzyl alcohol |
Engelse naam |
3-Benzyloxybenzyl alcohol; [3-(benzyloxy)phenyl]methanol; [3-(benzyloxy)phenyl]acetonitrile |
MF |
C15H13NO |
Molecuulgewicht |
223.2698 |
InChI |
InChI=1/C15H13NO/c16-10-9-13-7-4-8-15(11-13)17-12-14-5-2-1-3-6-14/h1-8,11H,9,12H2 |
CAS-nummer |
1700-30-7 |
EINECS |
216-931-2 |
Moleculaire Structuur |
|
Dichtheid |
1.114g/cm3 |
Smeltpunt |
47-52℃ |
Kookpunt |
387°C at 760 mmHg |
Brekingsindex |
1.582 |
Vlampunt |
162.9°C |
Dampdruk |
3.39E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|