ChemNet > CAS > 170229-98-8 4-Bromo-3-methylbenzamide
170229-98-8 4-Bromo-3-methylbenzamide
Naam product |
4-Bromo-3-methylbenzamide |
Engelse naam |
4-Bromo-3-methylbenzamide; |
MF |
C8H8BrNO |
Molecuulgewicht |
214.0592 |
InChI |
InChI=1/C8H8BrNO/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H2,10,11) |
CAS-nummer |
170229-98-8 |
Moleculaire Structuur |
|
Dichtheid |
1.522g/cm3 |
Kookpunt |
280.4°C at 760 mmHg |
Brekingsindex |
1.593 |
Vlampunt |
123.4°C |
Dampdruk |
0.00378mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|