ChemNet > CAS > 171058-18-7 1-Decyl-3-methylimidazoliumchloride
171058-18-7 1-Decyl-3-methylimidazoliumchloride
Naam product |
1-Decyl-3-methylimidazoliumchloride |
Engelse naam |
1-Decyl-3-methylimidazolium chloride; |
MF |
C14H29ClN2 |
Molecuulgewicht |
260.8465 |
InChI |
InChI=1/C14H28N2.ClH/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;/h12-13H,3-11,14H2,1-2H3;1H |
CAS-nummer |
171058-18-7 |
Moleculaire Structuur |
|
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|