ChemNet > CAS > 1712-87-4 m-Toluoyl and benzoyl peroxide
1712-87-4 m-Toluoyl and benzoyl peroxide
Naam product |
m-Toluoyl and benzoyl peroxide |
Engelse naam |
m-Toluoyl and benzoyl peroxide;Peroxide, bis(3-methylbenzoyl); Di-(2-methylbenzoyl)peroxide; Nyper MT; Nyper MT 80; m-Methylbenzoyl peroxide; m-Toluoyl peroxide; bis(3-methylphenyl)peroxyanhydride |
MF |
C16H14O4 |
Molecuulgewicht |
270.28 |
InChI |
InChI=1/C16H14O4/c1-11-5-3-7-13(9-11)15(17)19-20-16(18)14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
CAS-nummer |
1712-87-4 |
Moleculaire Structuur |
|
Dichtheid |
1.198g/cm3 |
Kookpunt |
404.508°C at 760 mmHg |
Brekingsindex |
1.573 |
Vlampunt |
179.191°C |
Dampdruk |
0mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|