ChemNet > CAS > 1730-48-9 6-Methoxy-1,2,3,4-tetrahydronaphthalene
1730-48-9 6-Methoxy-1,2,3,4-tetrahydronaphthalene
Naam product |
6-Methoxy-1,2,3,4-tetrahydronaphthalene |
Engelse naam |
6-Methoxy-1,2,3,4-tetrahydronaphthalene; methyl 1,2,3,4-tetrahydro-6-naphthyl ether; 6-Methoxytetralin |
MF |
C11H14O |
Molecuulgewicht |
162.2283 |
InChI |
InChI=1/C11H14O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h6-8H,2-5H2,1H3 |
CAS-nummer |
1730-48-9 |
EINECS |
217-049-0 |
Moleculaire Structuur |
|
Dichtheid |
1.012g/cm3 |
Kookpunt |
278.5°C at 760 mmHg |
Brekingsindex |
1.532 |
Vlampunt |
105.9°C |
Dampdruk |
0.0072mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|