ChemNet > CAS > 1742-95-6 4-Amino-1,8-naphthalimide
1742-95-6 4-Amino-1,8-naphthalimide
| Naam product |
4-Amino-1,8-naphthalimide |
| Engelse naam |
4-Amino-1,8-naphthalimide; |
| MF |
C12H8N2O2 |
| Molecuulgewicht |
212.2041 |
| InChI |
InChI=1/C12H8N2O2/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(15)14-12(8)16/h1-5H,13H2,(H,14,15,16) |
| CAS-nummer |
1742-95-6 |
| EINECS |
217-110-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.474g/cm3 |
| Smeltpunt |
360℃ |
| Kookpunt |
544.1°C at 760 mmHg |
| Brekingsindex |
1.764 |
| Vlampunt |
282.8°C |
| Dampdruk |
6.75E-12mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
