Naam product |
Dibenzo-30-kroon-10 |
Synoniemen |
;D ibenzo-30-kroon 10-ether; 6,7,9,10,12,13,15,16,23,24,26,27,29,30,32,33-hexadecahydrodibenzo[b,q][1,4,7,10,13,16,19,22,25,28]decaoxacyclotriacontine |
Engelse naam |
Dibenzo-30-crown-10; Dibenzo-30-crown 10-ether; 6,7,9,10,12,13,15,16,23,24,26,27,29,30,32,33-hexadecahydrodibenzo[b,q][1,4,7,10,13,16,19,22,25,28]decaoxacyclotriacontine |
MF |
C28H40O10 |
Molecuulgewicht |
536.6112 |
InChI |
InChI=1/C28H40O10/c1-2-6-26-25(5-1)35-21-17-31-13-9-29-11-15-33-19-23-37-27-7-3-4-8-28(27)38-24-20-34-16-12-30-10-14-32-18-22-36-26/h1-8H,9-24H2 |
CAS-nummer |
17455-25-3 |
Moleculaire Structuur |
|
Dichtheid |
1.068g/cm3 |
Smeltpunt |
104℃ |
Kookpunt |
671°C at 760 mmHg |
Brekingsindex |
1.465 |
Vlampunt |
259°C |
Dampdruk |
4.08E-17mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|