ChemNet > CAS > 175134-98-2 N-(3-Cyanophenyl)pyrrole
175134-98-2 N-(3-Cyanophenyl)pyrrole
Naam product |
N-(3-Cyanophenyl)pyrrole |
Engelse naam |
N-(3-Cyanophenyl)pyrrole; 3-(1-Pyrrolo)benzonitrile; 3-(1H-pyrrol-1-yl)benzonitrile |
MF |
C11H8N2 |
Molecuulgewicht |
168.1946 |
InChI |
InChI=1/C11H8N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H |
CAS-nummer |
175134-98-2 |
Moleculaire Structuur |
|
Dichtheid |
1.05g/cm3 |
Kookpunt |
306.3°C at 760 mmHg |
Brekingsindex |
1.589 |
Vlampunt |
139.1°C |
Dampdruk |
0.000776mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|