ChemNet > CAS > 175278-41-8 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylfenyl)acrylzuur
175278-41-8 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylfenyl)acrylzuur
Naam product |
3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylfenyl)acrylzuur |
Synoniemen |
(2E)-3-(3-nitro-4-pyrrolidine-1-ylfenyl)prop-2-eenzuur |
Engelse naam |
3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid;(2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
MF |
C13H14N2O4 |
Molecuulgewicht |
262.2613 |
InChI |
InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
CAS-nummer |
175278-41-8 |
Moleculaire Structuur |
|
Dichtheid |
1.37g/cm3 |
Smeltpunt |
243℃ |
Kookpunt |
483.9°C at 760 mmHg |
Brekingsindex |
1.657 |
Vlampunt |
246.5°C |
Dampdruk |
3.54E-10mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|