ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
Naam product |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
Engelse naam |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one;3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
MF |
C8H11ClO |
Molecuulgewicht |
158.6253 |
InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
CAS-nummer |
17530-69-7 |
Moleculaire Structuur |
|
Dichtheid |
1.09g/cm3 |
Kookpunt |
217.7°C at 760 mmHg |
Brekingsindex |
1.488 |
Vlampunt |
104.8°C |
Dampdruk |
0.131mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|