ChemNet > CAS > 1754-55-8 Ethyl 2,4,6-trimethylbenzoate
1754-55-8 Ethyl 2,4,6-trimethylbenzoate
Naam product |
Ethyl 2,4,6-trimethylbenzoate |
Engelse naam |
Ethyl 2,4,6-trimethylbenzoate; Ethyl mesitoate~2,4,6-Trimethylbenzoic acid ethyl ester |
MF |
C12H16O2 |
Molecuulgewicht |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-5-14-12(13)11-9(3)6-8(2)7-10(11)4/h6-7H,5H2,1-4H3 |
CAS-nummer |
1754-55-8 |
EINECS |
217-143-1 |
Moleculaire Structuur |
|
Dichtheid |
0.997g/cm3 |
Kookpunt |
257.8°C at 760 mmHg |
Brekingsindex |
1.504 |
Vlampunt |
113.8°C |
Dampdruk |
0.0143mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|