17609-48-2 H-D-Phg-OEt . HCl
Naam product |
H-D-Phg-OEt . HCl |
Engelse naam |
H-D-Phg-OEt . HCl; D-(-)-alpha-Phenylglycine ethyl ester hydrochloride; (R)-(-)-alpha-Aminophenylacetic acid ethyl ester hydrochloride~H-D-Phg-OEt.HCl; ethyl (2-aminophenyl)acetate hydrochloride; ethyl (2R)-amino(phenyl)ethanoate |
MF |
C10H13NO2 |
Molecuulgewicht |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9H,2,11H2,1H3/t9-/m1/s1 |
CAS-nummer |
17609-48-2 |
EINECS |
241-581-2 |
Moleculaire Structuur |
|
Dichtheid |
1.098g/cm3 |
Kookpunt |
257°C at 760 mmHg |
Brekingsindex |
1.529 |
Vlampunt |
120°C |
Dampdruk |
0.0149mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|