ChemNet > CAS > 178305-99-2 2-Fluorobiphenyl-4-boronic acid
178305-99-2 2-Fluorobiphenyl-4-boronic acid
Naam product |
2-Fluorobiphenyl-4-boronic acid |
Engelse naam |
2-Fluorobiphenyl-4-boronic acid; 3-Fluoro-4-phenylbenzeneboronic acid; 2-Fluoro-4-biphenylylboronic acid; (2-fluorobiphenyl-4-yl)boronic acid; (3-fluorobiphenyl-4-yl)boronic acid |
MF |
C12H10BFO2 |
Molecuulgewicht |
216.016 |
InChI |
InChI=1/C12H10BFO2/c14-12-8-10(6-7-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,15-16H |
CAS-nummer |
178305-99-2 |
Moleculaire Structuur |
|
Dichtheid |
1.257g/cm3 |
Smeltpunt |
243-248℃ |
Kookpunt |
384.155°C at 760 mmHg |
Brekingsindex |
1.591 |
Vlampunt |
186.131°C |
Dampdruk |
0mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S22:;
S24/25:;
|
|