ChemNet > CAS > 180-84-7 1,7-Dioxaspiro(5.5)undecane
180-84-7 1,7-Dioxaspiro(5.5)undecane
Naam product |
1,7-Dioxaspiro(5.5)undecane |
Engelse naam |
1,7-Dioxaspiro(5.5)undecane; Dioxaspiroundecane |
MF |
C9H16O2 |
Molecuulgewicht |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-3-7-10-9(5-1)6-2-4-8-11-9/h1-8H2 |
CAS-nummer |
180-84-7 |
EINECS |
205-870-7 |
Moleculaire Structuur |
|
Dichtheid |
1.02g/cm3 |
Kookpunt |
193.5°C at 760 mmHg |
Brekingsindex |
1.475 |
Vlampunt |
63.9°C |
Dampdruk |
0.645mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|