1801-72-5 1,3-Diallylurea
Naam product |
1,3-Diallylurea |
Engelse naam |
1,3-Diallylurea;NSC 102722; DAU; N,N'-Diallylurea; Urea, 1,3-diallyl- (8CI); Urea, N,N'-di-2-propenyl- (9CI); 1,3-diprop-2-en-1-ylurea |
MF |
C7H12N2O |
Molecuulgewicht |
140.183 |
InChI |
InChI=1/C7H12N2O/c1-3-5-8-7(10)9-6-4-2/h3-4H,1-2,5-6H2,(H2,8,9,10) |
CAS-nummer |
1801-72-5 |
EINECS |
217-291-7 |
Moleculaire Structuur |
|
Dichtheid |
0.94g/cm3 |
Smeltpunt |
90-93℃ |
Kookpunt |
285.3°C at 760 mmHg |
Brekingsindex |
1.464 |
Vlampunt |
129.6°C |
Dampdruk |
0.00282mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|