ChemNet > CAS > 18591-82-7 6-Methylpyridazin-3-amine
18591-82-7 6-Methylpyridazin-3-amine
Naam product |
6-Methylpyridazin-3-amine |
Engelse naam |
6-Methylpyridazin-3-amine; 3-Amino-6-Methylpyridazine |
MF |
C5H7N3 |
Molecuulgewicht |
109.13068 |
InChI |
InChI=1/C4H4IN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
CAS-nummer |
18591-82-7 |
EINECS |
242-430-3 |
Moleculaire Structuur |
|
Dichtheid |
2.204g/cm3 |
Smeltpunt |
230℃ |
Kookpunt |
399.6°C at 760 mmHg |
Brekingsindex |
1.719 |
Vlampunt |
195.5°C |
Dampdruk |
1.35E-06mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|