ChemNet > CAS > 186590-26-1 5-Bromo-2,3-difluorophenol
186590-26-1 5-Bromo-2,3-difluorophenol
| Naam product |
5-Bromo-2,3-difluorophenol |
| Engelse naam |
5-Bromo-2,3-difluorophenol; Bromodifluorophenol5; 3-Bromo-5,6-difluorophenol; 2,3-difluoro-5-bromophenol; bis[3-(trifluoromethyl)phenyl]methanone |
| MF |
C6H3BrF2O |
| Molecuulgewicht |
208.9882 |
| InChI |
InChI=1/C6H3BrF2O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| CAS-nummer |
186590-26-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.858g/cm3 |
| Kookpunt |
212.2°C at 760 mmHg |
| Brekingsindex |
1.549 |
| Vlampunt |
82.1°C |
| Dampdruk |
0.121mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
