ChemNet > CAS > 18729-48-1 3-Methylcyclopentanol, mixture of isomers
18729-48-1 3-Methylcyclopentanol, mixture of isomers
| Naam product |
3-Methylcyclopentanol, mixture of isomers |
| Engelse naam |
3-Methylcyclopentanol, mixture of isomers; 1-Methyl-3-cyclopentanol; 3-methylcyclopentanol; (1S,3S)-3-methylcyclopentanol |
| MF |
C6H12O |
| Molecuulgewicht |
100.1589 |
| InChI |
InChI=1/C6H12O/c1-5-2-3-6(7)4-5/h5-7H,2-4H2,1H3/t5-,6-/m0/s1 |
| CAS-nummer |
18729-48-1 |
| EINECS |
242-540-1 |
| Moleculaire Structuur |
|
| Dichtheid |
0.947g/cm3 |
| Kookpunt |
146.9°C at 760 mmHg |
| Brekingsindex |
1.467 |
| Vlampunt |
55°C |
| Dampdruk |
1.77mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R10:Flammable.;
|
| Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
|
|
