ChemNet > CAS > 1884-68-0 2,3,4,5-Tetraphenylthiophene
1884-68-0 2,3,4,5-Tetraphenylthiophene
Naam product |
2,3,4,5-Tetraphenylthiophene |
Engelse naam |
2,3,4,5-Tetraphenylthiophene; Tetraphenylthiophene |
MF |
C28H20S |
Molecuulgewicht |
388.5234 |
InChI |
InChI=1/C28H20S/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23/h1-20H |
CAS-nummer |
1884-68-0 |
EINECS |
217-545-7 |
Moleculaire Structuur |
|
Dichtheid |
1.142g/cm3 |
Kookpunt |
402.2°C at 760 mmHg |
Brekingsindex |
1.643 |
Vlampunt |
147.8°C |
Dampdruk |
2.58E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|