ChemNet > CAS > 18927-05-4 Methyl 3-methoxyphenylacetate
18927-05-4 Methyl 3-methoxyphenylacetate
Naam product |
Methyl 3-methoxyphenylacetate |
Engelse naam |
Methyl 3-methoxyphenylacetate; Methyl 2-(3-methoxyphenyl)acetate |
MF |
C10H12O3 |
Molecuulgewicht |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
CAS-nummer |
18927-05-4 |
Moleculaire Structuur |
|
Dichtheid |
1.083g/cm3 |
Kookpunt |
254°C at 760 mmHg |
Brekingsindex |
1.499 |
Vlampunt |
100.2°C |
Dampdruk |
0.0176mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|