ChemNet > CAS > 189331-47-3 5-broom-4-methylthiofeen-2-carbaldehyde
189331-47-3 5-broom-4-methylthiofeen-2-carbaldehyde
| Naam product |
5-broom-4-methylthiofeen-2-carbaldehyde |
| Synoniemen |
2-thiofeencarbaldehyde, 5-broom-4-methyl-; 2-thiofeencarboxaldehyde, 5-broom-4-methyl-; 5-broom-4-methyl-2-thiofeencarbaldehyde; 5-broom-4-methyl-2-thiofeencarboxaldehyde; 5-broom-4-methylthiofeen-2-carboxaldehyde; T5SJ BE C1 EVH [WLN] |
| Engelse naam |
5-bromo-4-methylthiophene-2-carbaldehyde; 2-Thiophenecarbaldehyde, 5-bromo-4-methyl-; 2-Thiophenecarboxaldehyde, 5-bromo-4-methyl-; 5-Bromo-4-methyl-2-thiophenecarbaldehyde; 5-Bromo-4-methyl-2-thiophenecarboxaldehyde; 5-Bromo-4-methylthiophene-2-carboxaldehyde; T5SJ BE C1 EVH [WLN] |
| MF |
C6H5BrOS |
| Molecuulgewicht |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c1-4-2-5(3-8)9-6(4)7/h2-3H,1H3 |
| CAS-nummer |
189331-47-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.667g/cm3 |
| Kookpunt |
264.996°C at 760 mmHg |
| Brekingsindex |
1.632 |
| Vlampunt |
114.066°C |
| Dampdruk |
0.009mmHg at 25°C |
|