ChemNet > CAS > 18937-79-6 Methyl 2-hexynoate
18937-79-6 Methyl 2-hexynoate
| Naam product |
Methyl 2-hexynoate |
| Engelse naam |
Methyl 2-hexynoate; 2-Hexynoic acid methyl ester; methyl hex-2-ynoate |
| MF |
C7H10O2 |
| Molecuulgewicht |
126.1531 |
| InChI |
InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-4H2,1-2H3 |
| CAS-nummer |
18937-79-6 |
| EINECS |
242-690-8 |
| Moleculaire Structuur |
|
| Dichtheid |
0.963g/cm3 |
| Kookpunt |
184.4°C at 760 mmHg |
| Brekingsindex |
1.436 |
| Vlampunt |
65.4°C |
| Dampdruk |
0.734mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
