1906-82-7 Ethyl acetamidoacetate
Naam product |
Ethyl acetamidoacetate |
Engelse naam |
Ethyl acetamidoacetate; ethyl N-acetylglycinate; Ethyl Acetamideacetate; ethyl 2-(acetylamino)acetate; Ac-Gly-OEt |
MF |
C6H11NO3 |
Molecuulgewicht |
145.1564 |
InChI |
InChI=1/C6H11NO3/c1-3-10-6(9)4-7-5(2)8/h3-4H2,1-2H3,(H,7,8) |
CAS-nummer |
1906-82-7 |
EINECS |
217-608-9 |
Moleculaire Structuur |
|
Dichtheid |
1.059g/cm3 |
Smeltpunt |
43-46℃ |
Kookpunt |
262.8°C at 760 mmHg |
Brekingsindex |
1.428 |
Vlampunt |
110.9°C |
Dampdruk |
0.0107mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|