ChemNet > CAS > 1919-48-8 2,4,6-Triphenoxy-s-triazine
1919-48-8 2,4,6-Triphenoxy-s-triazine
Naam product |
2,4,6-Triphenoxy-s-triazine |
Engelse naam |
2,4,6-Triphenoxy-s-triazine; 1,3,5-triazine, 2,4,6-triphenyl-; Triphenyl-s-triazine; 2,4,6-triphenoxy-1,3,5-triazine |
MF |
C21H15N3O3 |
Molecuulgewicht |
357.3621 |
InChI |
InChI=1/C21H15N3O3/c1-4-10-16(11-5-1)25-19-22-20(26-17-12-6-2-7-13-17)24-21(23-19)27-18-14-8-3-9-15-18/h1-15H |
CAS-nummer |
1919-48-8 |
EINECS |
217-644-5 |
Moleculaire Structuur |
|
Dichtheid |
1.272g/cm3 |
Smeltpunt |
232-237℃ |
Kookpunt |
537.8°C at 760 mmHg |
Brekingsindex |
1.629 |
Vlampunt |
189.2°C |
Dampdruk |
4.3E-11mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|