ChemNet > CAS > 1921-70-6 2,6,10,14-Tetramethylpentadecane
1921-70-6 2,6,10,14-Tetramethylpentadecane
Naam product |
2,6,10,14-Tetramethylpentadecane |
Engelse naam |
2,6,10,14-Tetramethylpentadecane; |
MF |
C19H40 |
Molecuulgewicht |
268.5209 |
InChI |
InChI=1/C19H40/c1-16(2)10-7-12-18(5)14-9-15-19(6)13-8-11-17(3)4/h16-19H,7-15H2,1-6H3 |
CAS-nummer |
1921-70-6 |
EINECS |
217-650-8 |
Moleculaire Structuur |
|
Dichtheid |
0.781g/cm3 |
Kookpunt |
296°C at 760 mmHg |
Brekingsindex |
1.436 |
Vlampunt |
140.7°C |
Dampdruk |
0.0026mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|