ChemNet > CAS > 19234-20-9 (2-isopropoxyethyl)acetaat
19234-20-9 (2-isopropoxyethyl)acetaat
| Naam product |
(2-isopropoxyethyl)acetaat |
| Synoniemen |
Isopropylglycolacetaat; Ethyleenglycolmonoisopropyletheracetaat; 2-(propaan-2-yloxy)ethylacetaat |
| Engelse naam |
(2-Isopropoxyethyl) acetate; Isopropylglycol acetate; Ethyleneglycol monoisopropyl ether acetate; 2-(propan-2-yloxy)ethyl acetate |
| MF |
C7H14O3 |
| Molecuulgewicht |
146.1843 |
| InChI |
InChI=1/C7H14O3/c1-6(2)9-4-5-10-7(3)8/h6H,4-5H2,1-3H3 |
| CAS-nummer |
19234-20-9 |
| EINECS |
242-901-3 |
| Moleculaire Structuur |
|
| Dichtheid |
0.947g/cm3 |
| Kookpunt |
177.6°C at 760 mmHg |
| Brekingsindex |
1.406 |
| Vlampunt |
56.8°C |
| Dampdruk |
1.03mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R10:Flammable.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
