ChemNet > CAS > 19241-16-8 2,6-Dimethylphenyl isothiocyanate
19241-16-8 2,6-Dimethylphenyl isothiocyanate
| Naam product |
2,6-Dimethylphenyl isothiocyanate |
| Engelse naam |
2,6-Dimethylphenyl isothiocyanate; 2,6-Dimethylisothiocyanatobenzene; 2-isothiocyanato-1,3-dimethylbenzene |
| MF |
C9H9NS |
| Molecuulgewicht |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-7-4-3-5-8(2)9(7)10-6-11/h3-5H,1-2H3 |
| CAS-nummer |
19241-16-8 |
| EINECS |
242-906-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.01g/cm3 |
| Kookpunt |
267°C at 760 mmHg |
| Brekingsindex |
1.554 |
| Vlampunt |
116.7°C |
| Dampdruk |
0.0138mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
