ChemNet > CAS > 19241-19-1 2-ethylphenyl isothiocyanate
19241-19-1 2-ethylphenyl isothiocyanate
| Naam product |
2-ethylphenyl isothiocyanate |
| Engelse naam |
2-ethylphenyl isothiocyanate; 2-Ethylisothiocyanatobenzene; 1-ethyl-2-isothiocyanatobenzene |
| MF |
C9H9NS |
| Molecuulgewicht |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-5-3-4-6-9(8)10-7-11/h3-6H,2H2,1H3 |
| CAS-nummer |
19241-19-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.01g/cm3 |
| Kookpunt |
264.8°C at 760 mmHg |
| Brekingsindex |
1.553 |
| Vlampunt |
115.1°C |
| Dampdruk |
0.0155mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
