ChemNet > CAS > 1930-72-9 4-Chloro-3,5-dinitrobenzonitrile
1930-72-9 4-Chloro-3,5-dinitrobenzonitrile
Naam product |
4-Chloro-3,5-dinitrobenzonitrile |
Engelse naam |
4-Chloro-3,5-dinitrobenzonitrile;Benzonitrile, 4-chloro-3,5-dinitro-; 4-Chloro-3,5-dinitrobenzenenitrile; AI3-28718; BRN 1990451; NSC 74453 |
MF |
C7H2ClN3O4 |
Molecuulgewicht |
227.5615 |
InChI |
InChI=1/C7H2ClN3O4/c8-7-5(10(12)13)1-4(3-9)2-6(7)11(14)15/h1-2H |
CAS-nummer |
1930-72-9 |
EINECS |
217-686-4 |
Moleculaire Structuur |
|
Dichtheid |
1.68g/cm3 |
Smeltpunt |
137-143℃ |
Kookpunt |
326.3°C at 760 mmHg |
Brekingsindex |
1.631 |
Vlampunt |
151.2°C |
Dampdruk |
0.000217mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|