ChemNet > CAS > 19398-61-9 2,5-Dichlorotoluene
19398-61-9 2,5-Dichlorotoluene
| Naam product |
2,5-Dichlorotoluene |
| Engelse naam |
2,5-Dichlorotoluene;Benzene, 1,4-dichloro-2-methyl-; NSC 86117; Toluene, 2,5-dichloro- (8CI); 1,4-dichloro-2-methylbenzene |
| MF |
C7H6Cl2 |
| Molecuulgewicht |
161.0285 |
| InChI |
InChI=1/C7H6Cl2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| CAS-nummer |
19398-61-9 |
| EINECS |
243-032-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.242g/cm3 |
| Smeltpunt |
4-5℃ |
| Kookpunt |
197.4°C at 760 mmHg |
| Brekingsindex |
1.543 |
| Vlampunt |
79.4°C |
| Dampdruk |
0.533mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
