ChemNet > CAS > 1947-47-3 3-Amino-2-phenylindenone
1947-47-3 3-Amino-2-phenylindenone
Naam product |
3-Amino-2-phenylindenone |
Engelse naam |
3-Amino-2-phenylindenone; 3-Amino-2-phenyl-1H-inden-1-one; (2R,3Z)-3-imino-2-phenyl-2,3-dihydro-1H-inden-1-one |
MF |
C15H11NO |
Molecuulgewicht |
221.2539 |
InChI |
InChI=1/C15H11NO/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,13,16H/b16-14+/t13-/m1/s1 |
CAS-nummer |
1947-47-3 |
Moleculaire Structuur |
|
Dichtheid |
1.21g/cm3 |
Smeltpunt |
270℃ |
Kookpunt |
415.6°C at 760 mmHg |
Brekingsindex |
1.652 |
Vlampunt |
205.1°C |
Dampdruk |
4.09E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|