ChemNet > CAS > 19819-98-8 2-Methylphenethyl alcohol
19819-98-8 2-Methylphenethyl alcohol
Naam product |
2-Methylphenethyl alcohol |
Engelse naam |
2-Methylphenethyl alcohol; 2-o-tolylethanol; 2-(2-Methylphenyl)ethanol |
MF |
C9H12O |
Molecuulgewicht |
136.191 |
InChI |
InChI=1/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS-nummer |
19819-98-8 |
EINECS |
243-349-6 |
Moleculaire Structuur |
|
Dichtheid |
1.001g/cm3 |
Kookpunt |
243.5°C at 760 mmHg |
Brekingsindex |
1.532 |
Vlampunt |
108.3°C |
Dampdruk |
0.0172mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|