ChemNet > CAS > 19832-98-5 4-Methyl-1-tetralone
19832-98-5 4-Methyl-1-tetralone
| Naam product |
4-Methyl-1-tetralone |
| Engelse naam |
4-Methyl-1-tetralone; 1,2,3,4-tetrahydro-4-methylnaphthalen-1-one; 4-methyl-3,4-dihydronaphthalen-1(2H)-one; (4R)-4-methyl-3,4-dihydronaphthalen-1(2H)-one; (4S)-4-methyl-3,4-dihydronaphthalen-1(2H)-one |
| MF |
C11H12O |
| Molecuulgewicht |
160.2124 |
| InChI |
InChI=1/C11H12O/c1-8-6-7-11(12)10-5-3-2-4-9(8)10/h2-5,8H,6-7H2,1H3/t8-/m0/s1 |
| CAS-nummer |
19832-98-5 |
| EINECS |
243-355-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.048g/cm3 |
| Kookpunt |
275.2°C at 760 mmHg |
| Brekingsindex |
1.539 |
| Vlampunt |
100.7°C |
| Dampdruk |
0.00515mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
