ChemNet > CAS > 1984-59-4 2,3-Dichloroanisole
1984-59-4 2,3-Dichloroanisole
| Naam product |
2,3-Dichloroanisole |
| Engelse naam |
2,3-Dichloroanisole; 1,2-Dichloro-3-methoxybenzene; ; 1,2-dichloro-3-methoxybenzene |
| MF |
C7H6Cl2O |
| Molecuulgewicht |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 |
| CAS-nummer |
1984-59-4 |
| EINECS |
217-853-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.289g/cm3 |
| Smeltpunt |
30-35℃ |
| Kookpunt |
223.4°C at 760 mmHg |
| Brekingsindex |
1.534 |
| Vlampunt |
94.7°C |
| Dampdruk |
0.144mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
