ChemNet > CAS > 19952-47-7 2-Amino-4-chlorobenzothiazole
19952-47-7 2-Amino-4-chlorobenzothiazole
Naam product |
2-Amino-4-chlorobenzothiazole |
Engelse naam |
2-Amino-4-chlorobenzothiazole; 4-chloro-1,3-benzothiazol-2-ylamine; 4-chlorobenzo[d]thiazol-2-amine; 4-chloro-1,3-benzothiazol-2-amine |
MF |
C7H5ClN2S |
Molecuulgewicht |
184.646 |
InChI |
InChI=1/C7H5ClN2S/c8-4-2-1-3-5-6(4)10-7(9)11-5/h1-3H,(H2,9,10) |
CAS-nummer |
19952-47-7 |
EINECS |
243-439-5 |
Moleculaire Structuur |
|
Dichtheid |
1.532g/cm3 |
Smeltpunt |
203-208℃ |
Kookpunt |
344.3°C at 760 mmHg |
Brekingsindex |
1.762 |
Vlampunt |
162°C |
Dampdruk |
6.65E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|