ChemNet > CAS > 2001-29-8 benzyl 4-brornophenyl ketone
2001-29-8 benzyl 4-brornophenyl ketone
Naam product |
benzyl 4-brornophenyl ketone |
Engelse naam |
benzyl 4-brornophenyl ketone; 4-Bromodeoxybenzoin~4-Bromo-alpha-phenylacetophenone; Benzyl 4-bromophenyl ketone; 1-(4-bromophenyl)-2-phenylethanone; 4'-Bromo-2-Phenylacetophenone |
MF |
C14H11BrO |
Molecuulgewicht |
275.1405 |
InChI |
InChI=1/C14H11BrO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
CAS-nummer |
2001-29-8 |
Moleculaire Structuur |
|
Dichtheid |
1.39g/cm3 |
Smeltpunt |
112-116℃ |
Kookpunt |
383.2°C at 760 mmHg |
Brekingsindex |
1.608 |
Vlampunt |
84.6°C |
Dampdruk |
4.47E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|