2001-93-6 Dithiouracil
Naam product |
Dithiouracil |
Engelse naam |
Dithiouracil; 2,4(1H,3H)-Pyrimidinedithione; 2,4-Dithiopyrimidine; pyrimidine-2,4-dithiol; pyrimidine-2,4(1H,3H)-dithione; 2,4-dimercaptopyrimidine |
MF |
C4H4N2S2 |
Molecuulgewicht |
144.218 |
InChI |
InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
CAS-nummer |
2001-93-6 |
EINECS |
217-894-5 |
Moleculaire Structuur |
|
Dichtheid |
1.5g/cm3 |
Smeltpunt |
279-281℃ |
Kookpunt |
225.6°C at 760 mmHg |
Brekingsindex |
1.776 |
Vlampunt |
90.3°C |
Dampdruk |
0.0855mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|