ChemNet > CAS > 20028-53-9 2-Amino-5-chlorobenzaldehyde
20028-53-9 2-Amino-5-chlorobenzaldehyde
Naam product |
2-Amino-5-chlorobenzaldehyde |
Engelse naam |
2-Amino-5-chlorobenzaldehyde; 6-Amino-3-chlorobenzaldehyde |
MF |
C7H6ClNO |
Molecuulgewicht |
155.5816 |
InChI |
InChI=1/C7H6ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H,9H2 |
CAS-nummer |
20028-53-9 |
Moleculaire Structuur |
|
Dichtheid |
1.348g/cm3 |
Kookpunt |
288.1°C at 760 mmHg |
Brekingsindex |
1.651 |
Vlampunt |
128°C |
Dampdruk |
0.00239mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|