20280-81-3 4-Methoxycoumarin
Naam product |
4-Methoxycoumarin |
Engelse naam |
4-Methoxycoumarin;4-Methoxycourmarin; 2H-1-Benzopyran-2-one, 4-methoxy-; 4-methoxy-2H-chromen-2-one |
MF |
C10H8O3 |
Molecuulgewicht |
176.1687 |
InChI |
InChI=1/C10H8O3/c1-12-9-6-10(11)13-8-5-3-2-4-7(8)9/h2-6H,1H3 |
CAS-nummer |
20280-81-3 |
Moleculaire Structuur |
|
Dichtheid |
1.26g/cm3 |
Kookpunt |
347.8°C at 760 mmHg |
Brekingsindex |
1.581 |
Vlampunt |
144.5°C |
Dampdruk |
5.27E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|