ChemNet > CAS > 2033-30-9 5,6-Dimethyl-2-benzimidazolinone
2033-30-9 5,6-Dimethyl-2-benzimidazolinone
Naam product |
5,6-Dimethyl-2-benzimidazolinone |
Engelse naam |
5,6-Dimethyl-2-benzimidazolinone; 5,6-Dimethyl-2-hydroxybenzimidazole; 5,6-dimethyl-1,3-dihydro-2H-benzimidazol-2-one; 5,6-dimethyl-1H-benzo[d]imidazol-2(3H)-one |
MF |
C9H10N2O |
Molecuulgewicht |
162.1885 |
InChI |
InChI=1/C9H10N2O/c1-5-3-7-8(4-6(5)2)11-9(12)10-7/h3-4H,1-2H3,(H2,10,11,12) |
CAS-nummer |
2033-30-9 |
EINECS |
217-993-3 |
Moleculaire Structuur |
|
Dichtheid |
1.161g/cm3 |
Smeltpunt |
300℃ |
Kookpunt |
174°C at 760 mmHg |
Brekingsindex |
1.567 |
Vlampunt |
60.7°C |
Dampdruk |
1.23mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|