ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
| Naam product |
diethyl glutaconate, mixture of cis and tra |
| Engelse naam |
diethyl glutaconate, mixture of cis and tra; Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
| MF |
C9H14O4 |
| Molecuulgewicht |
186.2051 |
| InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
| CAS-nummer |
2049-67-4 |
| EINECS |
218-069-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.048g/cm3 |
| Kookpunt |
237°C at 760 mmHg |
| Brekingsindex |
1.445 |
| Vlampunt |
106.7°C |
| Dampdruk |
0.0459mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
|
|
