ChemNet > CAS > 2049-96-9 n-Amyl benzoate
2049-96-9 n-Amyl benzoate
| Naam product |
n-Amyl benzoate |
| Engelse naam |
n-Amyl benzoate; pentyl benzoate; n-Amyl benzoate, (Benzoic acid n-amyl ester); N-pentyl benzoate |
| MF |
C12H16O2 |
| Molecuulgewicht |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-2-3-7-10-14-12(13)11-8-5-4-6-9-11/h4-6,8-9H,2-3,7,10H2,1H3 |
| CAS-nummer |
2049-96-9 |
| EINECS |
218-077-6 |
| Moleculaire Structuur |
|
| Dichtheid |
0.994g/cm3 |
| Kookpunt |
268.8°C at 760 mmHg |
| Brekingsindex |
1.496 |
| Vlampunt |
113.2°C |
| Dampdruk |
0.00752mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
