2050-23-9 Diethyl suberate
Naam product |
Diethyl suberate |
Engelse naam |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
MF |
C12H22O4 |
Molecuulgewicht |
230.3007 |
InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
CAS-nummer |
2050-23-9 |
EINECS |
218-084-4 |
Moleculaire Structuur |
|
Dichtheid |
0.985g/cm3 |
Smeltpunt |
5-284℃ |
Kookpunt |
282.6°C at 760 mmHg |
Brekingsindex |
1.436 |
Vlampunt |
123.3°C |
Dampdruk |
0.00332mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|