ChemNet > CAS > 20513-98-8 D-Glucorono-6,3-lactone acetonide
20513-98-8 D-Glucorono-6,3-lactone acetonide
Naam product |
D-Glucorono-6,3-lactone acetonide |
Engelse naam |
D-Glucorono-6,3-lactone acetonide; D-Glucurono-6,3-lactone acetonide; 6-hydroxy-2,2-dimethyltetrahydrofuro[2',3':4,5]furo[2,3-d][1,3]dioxol-5(3bH)-one (non-preferred name) |
MF |
C9H12O6 |
Molecuulgewicht |
216.188 |
InChI |
InChI=1/C9H12O6/c1-9(2)14-6-5-4(13-8(6)15-9)3(10)7(11)12-5/h3-6,8,10H,1-2H3 |
CAS-nummer |
20513-98-8 |
Moleculaire Structuur |
|
Dichtheid |
1.41g/cm3 |
Kookpunt |
386°C at 760 mmHg |
Brekingsindex |
1.51 |
Vlampunt |
158.8°C |
Dampdruk |
1.5E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|